C25H25Cl2F2N3O2S — CID 87697702
5,6-bis(4-chlorophenyl)-3-(methoxymethyl)pyrazine-2-carbothioic S-acid;4,4-difluorocyclohexan-1-amine (PubChem CID 87697702) has the molecular formula C25H25Cl2F2N3O2S and a molecular weight of 540.46 g/mol. Its IUPAC name is 5,6-bis(4-chlorophenyl)-3-(methoxymethyl)pyrazine-2-carbothioic S-acid;4,4-difluorocyclohexan-1-amine.
| Compound Name | 5,6-bis(4-chlorophenyl)-3-(methoxymethyl)pyrazine-2-carbothioic S-acid;4,4-difluorocyclohexan-1-amine |
|---|---|
| PubChem CID | 87697702 |
| Molecular Formula | C25H25Cl2F2N3O2S |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | 5,6-bis(4-chlorophenyl)-3-(methoxymethyl)pyrazine-2-carbothioic S-acid;4,4-difluorocyclohexan-1-amine |
| SMILES | COCc1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nc1C(=O)S.NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H14Cl2N2O2S.C6H11F2N/c1-25-10-15-18(19(24)26)23-17(12-4-8-14(21)9-5-12)16(22-15)11-2-6-13(20)7-3-11;7-6(8)3-1-5(9)2-4-6/h2-9H,10H2,1H3,(H,24,26);5H,1-4,9H2 |
| InChIKey | OMLWBGNYWHYOPH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|