C22H32Cl2O7Si2 — CID 87750601
3-[3-carboxy-5-[chloro(dimethyl)silyl]bicyclo[2.2.1]heptane-2-carbonyl]oxycarbonyl-6-[chloro(dimethyl)silyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 87750601) has the molecular formula C22H32Cl2O7Si2 and a molecular weight of 535.57 g/mol. Its IUPAC name is 3-[3-carboxy-5-[chloro(dimethyl)silyl]bicyclo[2.2.1]heptane-2-carbonyl]oxycarbonyl-6-[chloro(dimethyl)silyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-[3-carboxy-5-[chloro(dimethyl)silyl]bicyclo[2.2.1]heptane-2-carbonyl]oxycarbonyl-6-[chloro(dimethyl)silyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 87750601 |
| Molecular Formula | C22H32Cl2O7Si2 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 3-[3-carboxy-5-[chloro(dimethyl)silyl]bicyclo[2.2.1]heptane-2-carbonyl]oxycarbonyl-6-[chloro(dimethyl)silyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | C[Si](C)(Cl)C1CC2CC1C(C(=O)O)C2C(=O)OC(=O)C1C2CC(C1C(=O)O)C([Si](C)(C)Cl)C2 |
| InChI | InChI=1S/C22H32Cl2O7Si2/c1-32(2,23)13-7-9-5-11(13)17(19(25)26)15(9)21(29)31-22(30)16-10-6-12(18(16)20(27)28)14(8-10)33(3,4)24/h9-18H,5-8H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | WQYQWMJUACWTKW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|