C20H24N4O2 — CID 87751097
(2R)-2-amino-4-[5,6-dimethyl-1-(4-methylphenyl)benzimidazol-2-yl]-N-hydroxybutanamide (PubChem CID 87751097) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2R)-2-amino-4-[5,6-dimethyl-1-(4-methylphenyl)benzimidazol-2-yl]-N-hydroxybutanamide.
| Compound Name | (2R)-2-amino-4-[5,6-dimethyl-1-(4-methylphenyl)benzimidazol-2-yl]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 87751097 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (2R)-2-amino-4-[5,6-dimethyl-1-(4-methylphenyl)benzimidazol-2-yl]-N-hydroxybutanamide |
| SMILES | Cc1ccc(-n2c(CC[C@@H](N)C(=O)NO)nc3cc(C)c(C)cc32)cc1 |
| InChI | InChI=1S/C20H24N4O2/c1-12-4-6-15(7-5-12)24-18-11-14(3)13(2)10-17(18)22-19(24)9-8-16(21)20(25)23-26/h4-7,10-11,16,26H,8-9,21H2,1-3H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | SFTBEVKTNITADQ-MRXNPFEDSA-N |
| XLogP | 2.72 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|