C18H36N2O5 — CID 87770327
(2S)-2,4-diamino-4-oxobutanoic acid;12-methyltridecanoic acid (PubChem CID 87770327) has the molecular formula C18H36N2O5 and a molecular weight of 360.50 g/mol. Its IUPAC name is (2S)-2,4-diamino-4-oxobutanoic acid;12-methyltridecanoic acid.
| Compound Name | (2S)-2,4-diamino-4-oxobutanoic acid;12-methyltridecanoic acid |
|---|---|
| PubChem CID | 87770327 |
| Molecular Formula | C18H36N2O5 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (2S)-2,4-diamino-4-oxobutanoic acid;12-methyltridecanoic acid |
| SMILES | CC(C)CCCCCCCCCCC(=O)O.NC(=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H28O2.C4H8N2O3/c1-13(2)11-9-7-5-3-4-6-8-10-12-14(15)16;5-2(4(8)9)1-3(6)7/h13H,3-12H2,1-2H3,(H,15,16);2H,1,5H2,(H2,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | OCCQCEQSQQBEGK-WNQIDUERSA-N |
| XLogP | 2.90 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|