C19H19Cl3N2O3S — CID 87785760
1-[2-chloro-5-(2,4-dichlorophenoxy)-4-hydroxyphenyl]-3-cyclohexyl-1-sulfanylurea (PubChem CID 87785760) has the molecular formula C19H19Cl3N2O3S and a molecular weight of 461.80 g/mol. Its IUPAC name is 1-[2-chloro-5-(2,4-dichlorophenoxy)-4-hydroxyphenyl]-3-cyclohexyl-1-sulfanylurea.
| Compound Name | 1-[2-chloro-5-(2,4-dichlorophenoxy)-4-hydroxyphenyl]-3-cyclohexyl-1-sulfanylurea |
|---|---|
| PubChem CID | 87785760 |
| Molecular Formula | C19H19Cl3N2O3S |
| Molecular Weight | 461.80 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 1-[2-chloro-5-(2,4-dichlorophenoxy)-4-hydroxyphenyl]-3-cyclohexyl-1-sulfanylurea |
| SMILES | O=C(NC1CCCCC1)N(S)c1cc(Oc2ccc(Cl)cc2Cl)c(O)cc1Cl |
| InChI | InChI=1S/C19H19Cl3N2O3S/c20-11-6-7-17(14(22)8-11)27-18-10-15(13(21)9-16(18)25)24(28)19(26)23-12-4-2-1-3-5-12/h6-10,12,25,28H,1-5H2,(H,23,26) |
| InChIKey | RNXWLMRMCXXPJY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.80 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|