C17H13Cl3N2O5S — CID 87786041
1-[2-chloro-5-(2,4-dichlorophenoxy)-4-hydroxyphenyl]-3-(2-oxooxolan-3-yl)-1-sulfanylurea (PubChem CID 87786041) has the molecular formula C17H13Cl3N2O5S and a molecular weight of 463.73 g/mol. Its IUPAC name is 1-[2-chloro-5-(2,4-dichlorophenoxy)-4-hydroxyphenyl]-3-(2-oxooxolan-3-yl)-1-sulfanylurea.
| Compound Name | 1-[2-chloro-5-(2,4-dichlorophenoxy)-4-hydroxyphenyl]-3-(2-oxooxolan-3-yl)-1-sulfanylurea |
|---|---|
| PubChem CID | 87786041 |
| Molecular Formula | C17H13Cl3N2O5S |
| Molecular Weight | 463.73 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | 1-[2-chloro-5-(2,4-dichlorophenoxy)-4-hydroxyphenyl]-3-(2-oxooxolan-3-yl)-1-sulfanylurea |
| SMILES | O=C1OCCC1NC(=O)N(S)c1cc(Oc2ccc(Cl)cc2Cl)c(O)cc1Cl |
| InChI | InChI=1S/C17H13Cl3N2O5S/c18-8-1-2-14(10(20)5-8)27-15-7-12(9(19)6-13(15)23)22(28)17(25)21-11-3-4-26-16(11)24/h1-2,5-7,11,23,28H,3-4H2,(H,21,25) |
| InChIKey | BCFCEACARMVZHB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.73 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|