C19H15F7N2O2 — CID 87791948
3-[[4,4,4-trifluoro-3-hydroxy-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-2-yl]amino]benzonitrile (PubChem CID 87791948) has the molecular formula C19H15F7N2O2 and a molecular weight of 436.33 g/mol. Its IUPAC name is 3-[[4,4,4-trifluoro-3-hydroxy-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-2-yl]amino]benzonitrile.
| Compound Name | 3-[[4,4,4-trifluoro-3-hydroxy-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 87791948 |
| Molecular Formula | C19H15F7N2O2 |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 3-[[4,4,4-trifluoro-3-hydroxy-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-2-yl]amino]benzonitrile |
| SMILES | N#Cc1cccc(NC(Cc2cccc(OC(F)(F)C(F)F)c2)C(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F7N2O2/c20-17(21)19(25,26)30-14-6-2-3-11(8-14)9-15(16(29)18(22,23)24)28-13-5-1-4-12(7-13)10-27/h1-8,15-17,28-29H,9H2 |
| InChIKey | YYSRMCWQYASEJZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|