C12H13ClN6O5S — CID 87825895
methyl (2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-2-carbamoyl-3,4-dihydroxythiolane-2-carboxylate (PubChem CID 87825895) has the molecular formula C12H13ClN6O5S and a molecular weight of 388.79 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-2-carbamoyl-3,4-dihydroxythiolane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-2-carbamoyl-3,4-dihydroxythiolane-2-carboxylate |
|---|---|
| PubChem CID | 87825895 |
| Molecular Formula | C12H13ClN6O5S |
| Molecular Weight | 388.79 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | methyl (2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-2-carbamoyl-3,4-dihydroxythiolane-2-carboxylate |
| SMILES | COC(=O)[C@]1(C(N)=O)S[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H13ClN6O5S/c1-24-10(23)12(9(15)22)5(21)4(20)8(25-12)19-2-16-3-6(14)17-11(13)18-7(3)19/h2,4-5,8,20-21H,1H3,(H2,15,22)(H2,14,17,18)/t4-,5+,8-,12+/m1/s1 |
| InChIKey | AVNGIKKRRODITB-GCHCSJOXSA-N |
| XLogP | -1.57 |
| TPSA | 179.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.79 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|