C14H19ClN5O8PS — CID 118469546
[1-[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-ethoxy-1-methylsulfanyl-2-oxoethyl]phosphonic acid (PubChem CID 118469546) has the molecular formula C14H19ClN5O8PS and a molecular weight of 483.83 g/mol. Its IUPAC name is [1-[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-ethoxy-1-methylsulfanyl-2-oxoethyl]phosphonic acid.
| Compound Name | [1-[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-ethoxy-1-methylsulfanyl-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 118469546 |
| Molecular Formula | C14H19ClN5O8PS |
| Molecular Weight | 483.83 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | [1-[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-ethoxy-1-methylsulfanyl-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)C(SC)([C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C14H19ClN5O8PS/c1-3-27-12(23)14(30-2,29(24,25)26)8-6(21)7(22)11(28-8)20-4-17-5-9(16)18-13(15)19-10(5)20/h4,6-8,11,21-22H,3H2,1-2H3,(H2,16,18,19)(H2,24,25,26)/t6-,7+,8-,11+,14?/m0/s1 |
| InChIKey | FLDQESWYAFGRIX-YOAHZTTGSA-N |
| XLogP | -0.52 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.83 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|