C23H21F21NO+ — CID 87836194
triethyl-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecoxy(phenyl)methyl]azanium (PubChem CID 87836194) has the molecular formula C23H21F21NO+ and a molecular weight of 726.38 g/mol. Its IUPAC name is triethyl-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecoxy(phenyl)methyl]azanium.
| Compound Name | triethyl-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecoxy(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 87836194 |
| Molecular Formula | C23H21F21NO+ |
| Molecular Weight | 726.38 g/mol |
| Exact Mass | 726.13 |
| IUPAC Name | triethyl-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecoxy(phenyl)methyl]azanium |
| SMILES | CC[N+](CC)(CC)C(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C23H21F21NO/c1-4-45(5-2,6-3)13(12-10-8-7-9-11-12)46-23(43,44)21(38,39)19(34,35)17(30,31)15(26,27)14(24,25)16(28,29)18(32,33)20(36,37)22(40,41)42/h7-11,13H,4-6H2,1-3H3/q+1 |
| InChIKey | UICOHDCVQHGWHI-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.38 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|