C14H11Cl2NO3S — CID 87855510
5-[[1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]thiophene-2-carboxylic acid (PubChem CID 87855510) has the molecular formula C14H11Cl2NO3S and a molecular weight of 344.22 g/mol. Its IUPAC name is 5-[[1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 87855510 |
| Molecular Formula | C14H11Cl2NO3S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 5-[[1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]thiophene-2-carboxylic acid |
| SMILES | CC(=NOCc1ccc(C(=O)O)s1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2NO3S/c1-8(9-2-4-11(15)12(16)6-9)17-20-7-10-3-5-13(21-10)14(18)19/h2-6H,7H2,1H3,(H,18,19) |
| InChIKey | WIZPFALEMKQSRK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|