About (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine
(E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine (PubChem CID 87867627) has the molecular formula C17H21N5O
and a molecular weight of 311.39 g/mol. Its IUPAC name is (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine.
Molecular Properties
| Compound Name | (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine |
| PubChem CID | 87867627 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine |
| SMILES | CCCc1nc2cnc3cccnc3c2n1CCC/C=N/OC |
| InChI | InChI=1S/C17H21N5O/c1-3-7-15-21-14-12-19-13-8-6-9-18-16(13)17(14)22(15)11-5-4-10-20-23-2/h6,8-10,12H,3-5,7,11H2,1-2H3/b20-10+ |
| InChIKey | FGVAVSPHMIDDFR-KEBDBYFISA-N |
| XLogP | 3.34 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine?
The IUPAC name of (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine (CID 87867627) is (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine.
What is the SMILES notation for (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine?
The canonical SMILES for (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine is CCCc1nc2cnc3cccnc3c2n1CCC/C=N/OC.
What is the InChIKey of (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine?
The InChIKey is FGVAVSPHMIDDFR-KEBDBYFISA-N. The full InChI is InChI=1S/C17H21N5O/c1-3-7-15-21-14-12-19-13-8-6-9-18-16(13)17(14)22(15)11-5-4-10-20-23-2/h6,8-10,12H,3-5,7,11H2,1-2H3/b20-10+.
What are the key properties of (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine?
(E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine has a molecular weight of 311.39 g/mol, XLogP of 3.34, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-methoxy-4-(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)butan-1-imine is sourced from PubChem (CID 87867627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).