C15H9Cl2N3O3 — CID 87890391
N-(1,3-benzoxazol-5-yl)-N-[(3,4-dichlorophenyl)carbamoyl]formamide (PubChem CID 87890391) has the molecular formula C15H9Cl2N3O3 and a molecular weight of 350.16 g/mol. Its IUPAC name is N-(1,3-benzoxazol-5-yl)-N-[(3,4-dichlorophenyl)carbamoyl]formamide.
| Compound Name | N-(1,3-benzoxazol-5-yl)-N-[(3,4-dichlorophenyl)carbamoyl]formamide |
|---|---|
| PubChem CID | 87890391 |
| Molecular Formula | C15H9Cl2N3O3 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | N-(1,3-benzoxazol-5-yl)-N-[(3,4-dichlorophenyl)carbamoyl]formamide |
| SMILES | O=CN(C(=O)Nc1ccc(Cl)c(Cl)c1)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C15H9Cl2N3O3/c16-11-3-1-9(5-12(11)17)19-15(22)20(8-21)10-2-4-14-13(6-10)18-7-23-14/h1-8H,(H,19,22) |
| InChIKey | OKRQWJJAGPPTJQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|