C16H25F2N3O — CID 87891885
2-[(3-amino-1-adamantyl)amino]-2-(3,3-difluoropyrrolidin-1-yl)acetaldehyde (PubChem CID 87891885) has the molecular formula C16H25F2N3O and a molecular weight of 313.39 g/mol. Its IUPAC name is 2-[(3-amino-1-adamantyl)amino]-2-(3,3-difluoropyrrolidin-1-yl)acetaldehyde.
| Compound Name | 2-[(3-amino-1-adamantyl)amino]-2-(3,3-difluoropyrrolidin-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 87891885 |
| Molecular Formula | C16H25F2N3O |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 2-[(3-amino-1-adamantyl)amino]-2-(3,3-difluoropyrrolidin-1-yl)acetaldehyde |
| SMILES | NC12CC3CC(C1)CC(NC(C=O)N1CCC(F)(F)C1)(C3)C2 |
| InChI | InChI=1S/C16H25F2N3O/c17-16(18)1-2-21(10-16)13(8-22)20-15-6-11-3-12(7-15)5-14(19,4-11)9-15/h8,11-13,20H,1-7,9-10,19H2 |
| InChIKey | DJIMKJQPGTVZJZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|