About 3-methylbut-2-en-2-yl 2-bromoacetate
3-methylbut-2-en-2-yl 2-bromoacetate (PubChem CID 87891994) has the molecular formula C7H11BrO2
and a molecular weight of 207.07 g/mol. Its IUPAC name is 3-methylbut-2-en-2-yl 2-bromoacetate.
Molecular Properties
| Compound Name | 3-methylbut-2-en-2-yl 2-bromoacetate |
| PubChem CID | 87891994 |
| Molecular Formula | C7H11BrO2 |
| Molecular Weight | 207.07 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 3-methylbut-2-en-2-yl 2-bromoacetate |
| SMILES | CC(C)=C(C)OC(=O)CBr |
| InChI | InChI=1S/C7H11BrO2/c1-5(2)6(3)10-7(9)4-8/h4H2,1-3H3 |
| InChIKey | WSEQFHIKWLIWMN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.07 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-en-2-yl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-en-2-yl 2-bromoacetate?
The IUPAC name of 3-methylbut-2-en-2-yl 2-bromoacetate (CID 87891994) is 3-methylbut-2-en-2-yl 2-bromoacetate.
What is the SMILES notation for 3-methylbut-2-en-2-yl 2-bromoacetate?
The canonical SMILES for 3-methylbut-2-en-2-yl 2-bromoacetate is CC(C)=C(C)OC(=O)CBr.
What is the InChIKey of 3-methylbut-2-en-2-yl 2-bromoacetate?
The InChIKey is WSEQFHIKWLIWMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrO2/c1-5(2)6(3)10-7(9)4-8/h4H2,1-3H3.
What are the key properties of 3-methylbut-2-en-2-yl 2-bromoacetate?
3-methylbut-2-en-2-yl 2-bromoacetate has a molecular weight of 207.07 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-en-2-yl 2-bromoacetate is sourced from PubChem (CID 87891994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).