C13H23N3O5S — CID 87900888
N-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-N-(methanesulfonamido)formamide (PubChem CID 87900888) has the molecular formula C13H23N3O5S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-N-(methanesulfonamido)formamide.
| Compound Name | N-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-N-(methanesulfonamido)formamide |
|---|---|
| PubChem CID | 87900888 |
| Molecular Formula | C13H23N3O5S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-N-(methanesulfonamido)formamide |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1N(C=O)NS(C)(=O)=O |
| InChI | InChI=1S/C13H23N3O5S/c1-5-13(2,3)11(18)12(19)15-8-6-7-10(15)16(9-17)14-22(4,20)21/h9-10,14H,5-8H2,1-4H3 |
| InChIKey | BAUFQSQBPFIGST-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|