C31H44Cl2N2O3Pt — CID 87901272
dichloroplatinum;(13S,16R,17R)-16-(hydroxymethyl)-13-methyl-16-[6-(pyridin-2-ylmethylamino)hexyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 87901272) has the molecular formula C31H44Cl2N2O3Pt and a molecular weight of 758.69 g/mol. Its IUPAC name is dichloroplatinum;(13S,16R,17R)-16-(hydroxymethyl)-13-methyl-16-[6-(pyridin-2-ylmethylamino)hexyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | dichloroplatinum;(13S,16R,17R)-16-(hydroxymethyl)-13-methyl-16-[6-(pyridin-2-ylmethylamino)hexyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 87901272 |
| Molecular Formula | C31H44Cl2N2O3Pt |
| Molecular Weight | 758.69 g/mol |
| Exact Mass | 757.24 |
| IUPAC Name | dichloroplatinum;(13S,16R,17R)-16-(hydroxymethyl)-13-methyl-16-[6-(pyridin-2-ylmethylamino)hexyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1C[C@@](CO)(CCCCCCNCc1ccccn1)[C@@H]2O.Cl[Pt]Cl |
| InChI | InChI=1S/C31H44N2O3.2ClH.Pt/c1-30-15-13-26-25-12-10-24(35)18-22(25)9-11-27(26)28(30)19-31(21-34,29(30)36)14-5-2-3-6-16-32-20-23-8-4-7-17-33-23;;;/h4,7-8,10,12,17-18,26-29,32,34-36H,2-3,5-6,9,11,13-16,19-21H2,1H3;2*1H;/q;;;+2/p-2/t26?,27?,28?,29-,30+,31-;;;/m1.../s1 |
| InChIKey | NFVKJHZBJJFMMF-WCVHQVFSSA-L |
| XLogP | 6.71 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.69 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|