C28H33N3O2 — CID 88936424
(2Z)-2-[(13S)-3-hydroxy-13-methyl-17-methylidene-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-ylidene]-2-(methylamino)-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 88936424) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is (2Z)-2-[(13S)-3-hydroxy-13-methyl-17-methylidene-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-ylidene]-2-(methylamino)-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | (2Z)-2-[(13S)-3-hydroxy-13-methyl-17-methylidene-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-ylidene]-2-(methylamino)-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 88936424 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | (2Z)-2-[(13S)-3-hydroxy-13-methyl-17-methylidene-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-ylidene]-2-(methylamino)-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | C=C1/C(=C(\NC)C(=O)NCc2ccccn2)CC2C3CCc4cc(O)ccc4C3CC[C@]12C |
| InChI | InChI=1S/C28H33N3O2/c1-17-24(26(29-3)27(33)31-16-19-6-4-5-13-30-19)15-25-23-9-7-18-14-20(32)8-10-21(18)22(23)11-12-28(17,25)2/h4-6,8,10,13-14,22-23,25,29,32H,1,7,9,11-12,15-16H2,2-3H3,(H,31,33)/b26-24-/t22?,23?,25?,28-/m1/s1 |
| InChIKey | SEQTVRBDGUFWRQ-KVDSWHSFSA-N |
| XLogP | 4.60 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|