C33H48N2O3 — CID 87901475
(13S,16R,17R)-16-(hydroxymethyl)-13-methyl-16-[8-(pyridin-2-ylmethylamino)octyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 87901475) has the molecular formula C33H48N2O3 and a molecular weight of 520.76 g/mol. Its IUPAC name is (13S,16R,17R)-16-(hydroxymethyl)-13-methyl-16-[8-(pyridin-2-ylmethylamino)octyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (13S,16R,17R)-16-(hydroxymethyl)-13-methyl-16-[8-(pyridin-2-ylmethylamino)octyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 87901475 |
| Molecular Formula | C33H48N2O3 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.37 |
| IUPAC Name | (13S,16R,17R)-16-(hydroxymethyl)-13-methyl-16-[8-(pyridin-2-ylmethylamino)octyl]-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1C[C@@](CO)(CCCCCCCCNCc1ccccn1)[C@@H]2O |
| InChI | InChI=1S/C33H48N2O3/c1-32-17-15-28-27-14-12-26(37)20-24(27)11-13-29(28)30(32)21-33(23-36,31(32)38)16-7-4-2-3-5-8-18-34-22-25-10-6-9-19-35-25/h6,9-10,12,14,19-20,28-31,34,36-38H,2-5,7-8,11,13,15-18,21-23H2,1H3/t28?,29?,30?,31-,32+,33-/m1/s1 |
| InChIKey | CBJFDAIOBINAPW-DEMUEZOYSA-N |
| XLogP | 6.11 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|