C25H40O — CID 142141819
ethane;(8S,9R,13R,14R,16S,17S)-16-ethyl-13-methyl-16-propyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 142141819) has the molecular formula C25H40O and a molecular weight of 356.59 g/mol. Its IUPAC name is ethane;(8S,9R,13R,14R,16S,17S)-16-ethyl-13-methyl-16-propyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | ethane;(8S,9R,13R,14R,16S,17S)-16-ethyl-13-methyl-16-propyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 142141819 |
| Molecular Formula | C25H40O |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | ethane;(8S,9R,13R,14R,16S,17S)-16-ethyl-13-methyl-16-propyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC.CCC[C@@]1(CC)C[C@@H]2[C@H]3CCc4ccccc4[C@@H]3CC[C@@]2(C)[C@H]1O |
| InChI | InChI=1S/C23H34O.C2H6/c1-4-13-23(5-2)15-20-19-11-10-16-8-6-7-9-17(16)18(19)12-14-22(20,3)21(23)24;1-2/h6-9,18-21,24H,4-5,10-15H2,1-3H3;1-2H3/t18-,19-,20+,21+,22+,23-;/m0./s1 |
| InChIKey | XEWONCRNNZGCQU-LQFOMLOGSA-N |
| XLogP | 6.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |