C11H8N6O4S — CID 87908107
2-methylnaphthalene-1,4-dione;sulfuryl diazide (PubChem CID 87908107) has the molecular formula C11H8N6O4S and a molecular weight of 320.29 g/mol. Its IUPAC name is 2-methylnaphthalene-1,4-dione;sulfuryl diazide.
| Compound Name | 2-methylnaphthalene-1,4-dione;sulfuryl diazide |
|---|---|
| PubChem CID | 87908107 |
| Molecular Formula | C11H8N6O4S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-methylnaphthalene-1,4-dione;sulfuryl diazide |
| SMILES | CC1=CC(=O)c2ccccc2C1=O.[N-]=[N+]=NS(=O)(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C11H8O2.N6O2S/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13;1-3-5-9(7,8)6-4-2/h2-6H,1H3; |
| InChIKey | QEMCPPRXRFPKFF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 165.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|