C12H21O11PS2 — CID 87910354
3-[1-(2-methylprop-2-enoyloxy)ethenyl-(3-sulfopropoxy)phosphoryl]oxypropane-1-sulfonic acid (PubChem CID 87910354) has the molecular formula C12H21O11PS2 and a molecular weight of 436.40 g/mol. Its IUPAC name is 3-[1-(2-methylprop-2-enoyloxy)ethenyl-(3-sulfopropoxy)phosphoryl]oxypropane-1-sulfonic acid.
| Compound Name | 3-[1-(2-methylprop-2-enoyloxy)ethenyl-(3-sulfopropoxy)phosphoryl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87910354 |
| Molecular Formula | C12H21O11PS2 |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 3-[1-(2-methylprop-2-enoyloxy)ethenyl-(3-sulfopropoxy)phosphoryl]oxypropane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OC(=C)P(=O)(OCCCS(=O)(=O)O)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C12H21O11PS2/c1-10(2)12(13)23-11(3)24(14,21-6-4-8-25(15,16)17)22-7-5-9-26(18,19)20/h1,3-9H2,2H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | BFKRODRAPGNLOQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 170.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|