C8H18N4O — CID 87946743
(2S)-2-amino-6-(2-iminoethylamino)hexanamide (PubChem CID 87946743) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is (2S)-2-amino-6-(2-iminoethylamino)hexanamide.
| Compound Name | (2S)-2-amino-6-(2-iminoethylamino)hexanamide |
|---|---|
| PubChem CID | 87946743 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | (2S)-2-amino-6-(2-iminoethylamino)hexanamide |
| SMILES | [H]/N=C/CNCCCC[C@H](N)C(N)=O |
| InChI | InChI=1S/C8H18N4O/c9-4-6-12-5-2-1-3-7(10)8(11)13/h4,7,9,12H,1-3,5-6,10H2,(H2,11,13)/b9-4+/t7-/m0/s1 |
| InChIKey | WGFAEUUQNUSELX-FGROQZRYSA-N |
| XLogP | -0.79 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|