C11H24N4O4 — CID 172563452
(2R)-2-amino-6-[[3-hydroxy-2-(hydroxymethyl)propyl]carbamoylamino]hexanamide (PubChem CID 172563452) has the molecular formula C11H24N4O4 and a molecular weight of 276.34 g/mol. Its IUPAC name is (2R)-2-amino-6-[[3-hydroxy-2-(hydroxymethyl)propyl]carbamoylamino]hexanamide.
| Compound Name | (2R)-2-amino-6-[[3-hydroxy-2-(hydroxymethyl)propyl]carbamoylamino]hexanamide |
|---|---|
| PubChem CID | 172563452 |
| Molecular Formula | C11H24N4O4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (2R)-2-amino-6-[[3-hydroxy-2-(hydroxymethyl)propyl]carbamoylamino]hexanamide |
| SMILES | NC(=O)[C@H](N)CCCCNC(=O)NCC(CO)CO |
| InChI | InChI=1S/C11H24N4O4/c12-9(10(13)18)3-1-2-4-14-11(19)15-5-8(6-16)7-17/h8-9,16-17H,1-7,12H2,(H2,13,18)(H2,14,15,19)/t9-/m1/s1 |
| InChIKey | QZPUXHPQMSIXNB-SECBINFHSA-N |
| XLogP | -2.13 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|