C12H22N4O2 — CID 149254100
(2R,3R)-N-[(5S)-5,6-diamino-6-oxohexyl]-3-methyl-3,4-dihydro-2H-pyrrole-2-carboxamide (PubChem CID 149254100) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (2R,3R)-N-[(5S)-5,6-diamino-6-oxohexyl]-3-methyl-3,4-dihydro-2H-pyrrole-2-carboxamide.
| Compound Name | (2R,3R)-N-[(5S)-5,6-diamino-6-oxohexyl]-3-methyl-3,4-dihydro-2H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 149254100 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (2R,3R)-N-[(5S)-5,6-diamino-6-oxohexyl]-3-methyl-3,4-dihydro-2H-pyrrole-2-carboxamide |
| SMILES | C[C@@H]1CC=N[C@H]1C(=O)NCCCC[C@H](N)C(N)=O |
| InChI | InChI=1S/C12H22N4O2/c1-8-5-7-15-10(8)12(18)16-6-3-2-4-9(13)11(14)17/h7-10H,2-6,13H2,1H3,(H2,14,17)(H,16,18)/t8-,9+,10-/m1/s1 |
| InChIKey | NPVDEKYWSHRIDH-KXUCPTDWSA-N |
| XLogP | -0.44 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|