C7H17N2O3S+ — CID 143928963
3-(2,3-dihydroxypropylcarbamoylamino)propylsulfanium (PubChem CID 143928963) has the molecular formula C7H17N2O3S+ and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylcarbamoylamino)propylsulfanium.
| Compound Name | 3-(2,3-dihydroxypropylcarbamoylamino)propylsulfanium |
|---|---|
| PubChem CID | 143928963 |
| Molecular Formula | C7H17N2O3S+ |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-(2,3-dihydroxypropylcarbamoylamino)propylsulfanium |
| SMILES | O=C(NCCC[SH2+])NCC(O)CO |
| InChI | InChI=1S/C7H16N2O3S/c10-5-6(11)4-9-7(12)8-2-1-3-13/h6,10-11,13H,1-5H2,(H2,8,9,12)/p+1 |
| InChIKey | BUVLXJCPBKKEQI-UHFFFAOYSA-O |
| XLogP | -1.96 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|