C12H10F17NO — CID 87948492
2-(1,1,2,2,3,3,4,4,5,5,6,6,7,8,9,10,10-heptadecafluorodecoxy)ethanamine (PubChem CID 87948492) has the molecular formula C12H10F17NO and a molecular weight of 507.18 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,8,9,10,10-heptadecafluorodecoxy)ethanamine.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,8,9,10,10-heptadecafluorodecoxy)ethanamine |
|---|---|
| PubChem CID | 87948492 |
| Molecular Formula | C12H10F17NO |
| Molecular Weight | 507.18 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,8,9,10,10-heptadecafluorodecoxy)ethanamine |
| SMILES | NCCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C12H10F17NO/c13-3(4(14)6(16)17)5(15)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)12(28,29)31-2-1-30/h3-6H,1-2,30H2 |
| InChIKey | FUOKOHOSEKVWPN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.18 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|