C35H43N4O6+ — CID 87954666
N,1-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-1-ium-1-amine (PubChem CID 87954666) has the molecular formula C35H43N4O6+ and a molecular weight of 615.75 g/mol. Its IUPAC name is N,1-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-1-ium-1-amine.
| Compound Name | N,1-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-1-ium-1-amine |
|---|---|
| PubChem CID | 87954666 |
| Molecular Formula | C35H43N4O6+ |
| Molecular Weight | 615.75 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | N,1-bis[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-1-ium-1-amine |
| SMILES | COc1cc(-c2cc(CN[N+]3(Cc4ccnc(-c5cc(OC)c(OC)c(OC)c5)c4)CCCCC3)ccn2)cc(OC)c1OC |
| InChI | InChI=1S/C35H43N4O6/c1-40-30-18-26(19-31(41-2)34(30)44-5)28-16-24(10-12-36-28)22-38-39(14-8-7-9-15-39)23-25-11-13-37-29(17-25)27-20-32(42-3)35(45-6)33(21-27)43-4/h10-13,16-21,38H,7-9,14-15,22-23H2,1-6H3/q+1 |
| InChIKey | RHGMWZDJEYOSEF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.75 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|