C32H52O3Si — CID 87963693
(3R)-3-[(8S,9S,13R,14S,17R)-2-methoxy-13-methyl-3-tri(propan-2-yl)silyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]butanal (PubChem CID 87963693) has the molecular formula C32H52O3Si and a molecular weight of 512.85 g/mol. Its IUPAC name is (3R)-3-[(8S,9S,13R,14S,17R)-2-methoxy-13-methyl-3-tri(propan-2-yl)silyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]butanal.
| Compound Name | (3R)-3-[(8S,9S,13R,14S,17R)-2-methoxy-13-methyl-3-tri(propan-2-yl)silyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]butanal |
|---|---|
| PubChem CID | 87963693 |
| Molecular Formula | C32H52O3Si |
| Molecular Weight | 512.85 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | (3R)-3-[(8S,9S,13R,14S,17R)-2-methoxy-13-methyl-3-tri(propan-2-yl)silyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]butanal |
| SMILES | COc1cc2c(cc1O[Si](C(C)C)(C(C)C)C(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CC=O)CC[C@@H]12 |
| InChI | InChI=1S/C32H52O3Si/c1-20(2)36(21(3)4,22(5)6)35-31-18-24-10-11-26-25(27(24)19-30(31)34-9)14-16-32(8)28(12-13-29(26)32)23(7)15-17-33/h17-23,25-26,28-29H,10-16H2,1-9H3/t23-,25+,26-,28-,29+,32-/m1/s1 |
| InChIKey | MQSKMUNLGAUHRH-VYBYSDRGSA-N |
| XLogP | 8.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.85 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|