C19H22O3S — CID 87967976
3,3-dimethyl-2-[(4-phenoxyphenyl)-sulfanylmethyl]butanoic acid (PubChem CID 87967976) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(4-phenoxyphenyl)-sulfanylmethyl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[(4-phenoxyphenyl)-sulfanylmethyl]butanoic acid |
|---|---|
| PubChem CID | 87967976 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3,3-dimethyl-2-[(4-phenoxyphenyl)-sulfanylmethyl]butanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)C(S)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H22O3S/c1-19(2,3)16(18(20)21)17(23)13-9-11-15(12-10-13)22-14-7-5-4-6-8-14/h4-12,16-17,23H,1-3H3,(H,20,21) |
| InChIKey | LLBVAOJFQGLADC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|