About 2-methylpropyl dibromoarsanylformate
2-methylpropyl dibromoarsanylformate (PubChem CID 87971467) has the molecular formula C5H9AsBr2O2
and a molecular weight of 335.86 g/mol. Its IUPAC name is 2-methylpropyl dibromoarsanylformate.
Molecular Properties
| Compound Name | 2-methylpropyl dibromoarsanylformate |
| PubChem CID | 87971467 |
| Molecular Formula | C5H9AsBr2O2 |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 333.82 |
| IUPAC Name | 2-methylpropyl dibromoarsanylformate |
| SMILES | CC(C)COC(=O)[As](Br)Br |
| InChI | InChI=1S/C5H9AsBr2O2/c1-4(2)3-10-5(9)6(7)8/h4H,3H2,1-2H3 |
| InChIKey | IGMMBWUGOLCGIX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl dibromoarsanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl dibromoarsanylformate?
The IUPAC name of 2-methylpropyl dibromoarsanylformate (CID 87971467) is 2-methylpropyl dibromoarsanylformate.
What is the SMILES notation for 2-methylpropyl dibromoarsanylformate?
The canonical SMILES for 2-methylpropyl dibromoarsanylformate is CC(C)COC(=O)[As](Br)Br.
What is the InChIKey of 2-methylpropyl dibromoarsanylformate?
The InChIKey is IGMMBWUGOLCGIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9AsBr2O2/c1-4(2)3-10-5(9)6(7)8/h4H,3H2,1-2H3.
What are the key properties of 2-methylpropyl dibromoarsanylformate?
2-methylpropyl dibromoarsanylformate has a molecular weight of 335.86 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl dibromoarsanylformate is sourced from PubChem (CID 87971467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).