C30H22Cl2F7NO3 — CID 87973063
2-[3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-2-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 87973063) has the molecular formula C30H22Cl2F7NO3 and a molecular weight of 648.40 g/mol. Its IUPAC name is 2-[3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-2-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-[3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-2-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 87973063 |
| Molecular Formula | C30H22Cl2F7NO3 |
| Molecular Weight | 648.40 g/mol |
| Exact Mass | 647.09 |
| IUPAC Name | 2-[3-(2,3-dichlorophenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]-2-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | OCC(c1cccc(C(F)(F)F)c1)N(Cc1cccc(OC(F)(F)C(F)F)c1)c1cccc(Oc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C30H22Cl2F7NO3/c31-24-11-4-12-26(27(24)32)42-22-9-3-8-21(15-22)40(25(17-41)19-6-2-7-20(14-19)29(35,36)37)16-18-5-1-10-23(13-18)43-30(38,39)28(33)34/h1-15,25,28,41H,16-17H2 |
| InChIKey | LMLKGOFCBHKKGQ-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.40 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|