C32H27F8NO2 — CID 22564246
2-[3-(3-ethylphenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]-2-[2-(trifluoromethyl)phenyl]ethanol (PubChem CID 22564246) has the molecular formula C32H27F8NO2 and a molecular weight of 609.56 g/mol. Its IUPAC name is 2-[3-(3-ethylphenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]-2-[2-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-[3-(3-ethylphenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]-2-[2-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 22564246 |
| Molecular Formula | C32H27F8NO2 |
| Molecular Weight | 609.56 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 2-[3-(3-ethylphenoxy)-N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]anilino]-2-[2-(trifluoromethyl)phenyl]ethanol |
| SMILES | CCc1cccc(Oc2cccc(N(Cc3cccc(C(F)(F)C(F)(F)F)c3)C(CO)c3ccccc3C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C32H27F8NO2/c1-2-21-8-6-12-25(17-21)43-26-13-7-11-24(18-26)41(29(20-42)27-14-3-4-15-28(27)31(35,36)37)19-22-9-5-10-23(16-22)30(33,34)32(38,39)40/h3-18,29,42H,2,19-20H2,1H3 |
| InChIKey | CPXRCFGZADBRAS-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.56 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|