C10H10ClF3O — CID 87995556
[6-chloro-2,3,4-tris(fluoromethyl)phenyl]methanol (PubChem CID 87995556) has the molecular formula C10H10ClF3O and a molecular weight of 238.64 g/mol. Its IUPAC name is [6-chloro-2,3,4-tris(fluoromethyl)phenyl]methanol.
| Compound Name | [6-chloro-2,3,4-tris(fluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 87995556 |
| Molecular Formula | C10H10ClF3O |
| Molecular Weight | 238.64 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | [6-chloro-2,3,4-tris(fluoromethyl)phenyl]methanol |
| SMILES | OCc1c(Cl)cc(CF)c(CF)c1CF |
| InChI | InChI=1S/C10H10ClF3O/c11-10-1-6(2-12)7(3-13)8(4-14)9(10)5-15/h1,15H,2-5H2 |
| InChIKey | CJAHZXDBXSPEKV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |