C17H24N3O2S2+ — CID 8801322
[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]-bis(thiophen-2-ylmethyl)azanium (PubChem CID 8801322) has the molecular formula C17H24N3O2S2+ and a molecular weight of 366.53 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]-bis(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]-bis(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8801322 |
| Molecular Formula | C17H24N3O2S2+ |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]-bis(thiophen-2-ylmethyl)azanium |
| SMILES | CCCNC(=O)CNC(=O)C[NH+](Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C17H23N3O2S2/c1-2-7-18-16(21)10-19-17(22)13-20(11-14-5-3-8-23-14)12-15-6-4-9-24-15/h3-6,8-9H,2,7,10-13H2,1H3,(H,18,21)(H,19,22)/p+1 |
| InChIKey | SCUOWJGPMRENTI-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |