C17H14FN5O2S — CID 8812962
1-(4-fluorophenyl)-3-[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]thiourea (PubChem CID 8812962) has the molecular formula C17H14FN5O2S and a molecular weight of 371.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 8812962 |
| Molecular Formula | C17H14FN5O2S |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(F)cc1)c1nn(-c2ccccc2)cc1O |
| InChI | InChI=1S/C17H14FN5O2S/c18-11-6-8-12(9-7-11)19-17(26)21-20-16(25)15-14(24)10-23(22-15)13-4-2-1-3-5-13/h1-10,24H,(H,20,25)(H2,19,21,26) |
| InChIKey | CCZAZDRJSPVMJF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|