C14H13F3N4O4S — CID 8842471
4-[(1H-pyrrole-2-carbonylamino)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 8842471) has the molecular formula C14H13F3N4O4S and a molecular weight of 390.34 g/mol. Its IUPAC name is 4-[(1H-pyrrole-2-carbonylamino)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[(1H-pyrrole-2-carbonylamino)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 8842471 |
| Molecular Formula | C14H13F3N4O4S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 4-[(1H-pyrrole-2-carbonylamino)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(S(=O)(=O)NNC(=O)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C14H13F3N4O4S/c15-14(16,17)8-19-12(22)9-3-5-10(6-4-9)26(24,25)21-20-13(23)11-2-1-7-18-11/h1-7,18,21H,8H2,(H,19,22)(H,20,23) |
| InChIKey | SJTCWDKAYQFAGA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|