C26H18N2O6 — CID 88509875
3,4-bis(methylcarbamoyl)perylene-2,9-dicarboxylic acid (PubChem CID 88509875) has the molecular formula C26H18N2O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is 3,4-bis(methylcarbamoyl)perylene-2,9-dicarboxylic acid.
| Compound Name | 3,4-bis(methylcarbamoyl)perylene-2,9-dicarboxylic acid |
|---|---|
| PubChem CID | 88509875 |
| Molecular Formula | C26H18N2O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 3,4-bis(methylcarbamoyl)perylene-2,9-dicarboxylic acid |
| SMILES | CNC(=O)c1ccc2c3ccc(C(=O)O)c4cccc(c5cc(C(=O)O)c(C(=O)NC)c1c25)c43 |
| InChI | InChI=1S/C26H18N2O6/c1-27-23(29)16-9-7-14-13-6-8-15(25(31)32)11-4-3-5-12(19(11)13)17-10-18(26(33)34)22(24(30)28-2)21(16)20(14)17/h3-10H,1-2H3,(H,27,29)(H,28,30)(H,31,32)(H,33,34) |
| InChIKey | BPQGBRJCIMCEGF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|