C20H39NO3 — CID 88527412
2-ethyl-N-(2-ethylhexyl)hexan-1-amine;oxolane-2,5-dione (PubChem CID 88527412) has the molecular formula C20H39NO3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 2-ethyl-N-(2-ethylhexyl)hexan-1-amine;oxolane-2,5-dione.
| Compound Name | 2-ethyl-N-(2-ethylhexyl)hexan-1-amine;oxolane-2,5-dione |
|---|---|
| PubChem CID | 88527412 |
| Molecular Formula | C20H39NO3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | 2-ethyl-N-(2-ethylhexyl)hexan-1-amine;oxolane-2,5-dione |
| SMILES | CCCCC(CC)CNCC(CC)CCCC.O=C1CCC(=O)O1 |
| InChI | InChI=1S/C16H35N.C4H4O3/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2;5-3-1-2-4(6)7-3/h15-17H,5-14H2,1-4H3;1-2H2 |
| InChIKey | BKQZKHLPGFPDFH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|