C7H7N5O2 — CID 8853189
2-amino-3-methyl-8H-pteridine-4,7-dione (PubChem CID 8853189) has the molecular formula C7H7N5O2 and a molecular weight of 193.17 g/mol. Its IUPAC name is 2-amino-3-methyl-8H-pteridine-4,7-dione.
| Compound Name | 2-amino-3-methyl-8H-pteridine-4,7-dione |
|---|---|
| PubChem CID | 8853189 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-amino-3-methyl-8H-pteridine-4,7-dione |
| SMILES | Cn1c(N)nc2[nH]c(=O)cnc2c1=O |
| InChI | InChI=1S/C7H7N5O2/c1-12-6(14)4-5(11-7(12)8)10-3(13)2-9-4/h2H,1H3,(H3,8,10,11,13) |
| InChIKey | RFTAPWOOGAINRY-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |