C6H10N2O4 — CID 88536933
(6E)-6-hydroxyimino-1,4-oxazepane-4-carboxylic acid (PubChem CID 88536933) has the molecular formula C6H10N2O4 and a molecular weight of 174.16 g/mol. Its IUPAC name is (6E)-6-hydroxyimino-1,4-oxazepane-4-carboxylic acid.
| Compound Name | (6E)-6-hydroxyimino-1,4-oxazepane-4-carboxylic acid |
|---|---|
| PubChem CID | 88536933 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (6E)-6-hydroxyimino-1,4-oxazepane-4-carboxylic acid |
| SMILES | O=C(O)N1CCOC/C(=N/O)C1 |
| InChI | InChI=1S/C6H10N2O4/c9-6(10)8-1-2-12-4-5(3-8)7-11/h11H,1-4H2,(H,9,10)/b7-5+ |
| InChIKey | ZLNHUEPMMNTDNW-FNORWQNLSA-N |
| XLogP | -0.17 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|