C18H16Cl2N3O+ — CID 8854765
N-[(2,4-dichlorophenyl)methyl]-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide (PubChem CID 8854765) has the molecular formula C18H16Cl2N3O+ and a molecular weight of 361.25 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8854765 |
| Molecular Formula | C18H16Cl2N3O+ |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide |
| SMILES | C=Cn1c[n+](CC(=O)NCc2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C18H15Cl2N3O/c1-2-22-12-23(17-6-4-3-5-16(17)22)11-18(24)21-10-13-7-8-14(19)9-15(13)20/h2-9,12H,1,10-11H2/p+1 |
| InChIKey | BTGGYGYVLGQXKW-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|