C19H17B2O3S — CID 88547947
CID 88547947 (PubChem CID 88547947) has the molecular formula C19H17B2O3S and a molecular weight of 347.03 g/mol.
| Compound Name | CID 88547947 |
|---|---|
| PubChem CID | 88547947 |
| Molecular Formula | C19H17B2O3S |
| Molecular Weight | 347.03 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | — |
| SMILES | [B][B]CC(=O)COc1cc(C(C)C)c2sc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C19H17B2O3S/c1-11(2)15-7-13(24-10-12(22)9-21-20)8-16-18(23)14-5-3-4-6-17(14)25-19(15)16/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | JBHHFONOXHFXSR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.03 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|