C30H25Cl6N3OS — CID 159823184
2,4-di(propan-2-yl)thioxanthen-9-one;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 159823184) has the molecular formula C30H25Cl6N3OS and a molecular weight of 688.34 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)thioxanthen-9-one;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2,4-di(propan-2-yl)thioxanthen-9-one;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 159823184 |
| Molecular Formula | C30H25Cl6N3OS |
| Molecular Weight | 688.34 g/mol |
| Exact Mass | 684.98 |
| IUPAC Name | 2,4-di(propan-2-yl)thioxanthen-9-one;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | CC(C)c1cc(C(C)C)c2sc3ccccc3c(=O)c2c1.ClC(Cl)(Cl)c1nc(-c2ccccc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C19H20OS.C11H5Cl6N3/c1-11(2)13-9-15(12(3)4)19-16(10-13)18(20)14-7-5-6-8-17(14)21-19;12-10(13,14)8-18-7(6-4-2-1-3-5-6)19-9(20-8)11(15,16)17/h5-12H,1-4H3;1-5H |
| InChIKey | NMMRFTWJDBSFGE-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.34 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|