C18H13ClN2O3S — CID 88563943
(5Z)-5-[[4-[2-(3-chlorophenyl)-2-iminoethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 88563943) has the molecular formula C18H13ClN2O3S and a molecular weight of 372.83 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-(3-chlorophenyl)-2-iminoethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[2-(3-chlorophenyl)-2-iminoethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 88563943 |
| Molecular Formula | C18H13ClN2O3S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (5Z)-5-[[4-[2-(3-chlorophenyl)-2-iminoethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | [H]/N=C(/COc1ccc(/C=C2\SC(=O)NC2=O)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H13ClN2O3S/c19-13-3-1-2-12(9-13)15(20)10-24-14-6-4-11(5-7-14)8-16-17(22)21-18(23)25-16/h1-9,20H,10H2,(H,21,22,23)/b16-8-,20-15- |
| InChIKey | ILRDKSMRXJNZQT-SNKDOTLJSA-N |
| XLogP | 4.11 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|