C32H46N2O2S — CID 88576007
4-[3-[butyl(cyclohexyl)amino]propyl]-2-(2-methylphenyl)-N-[(2S)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 88576007) has the molecular formula C32H46N2O2S and a molecular weight of 522.80 g/mol. Its IUPAC name is 4-[3-[butyl(cyclohexyl)amino]propyl]-2-(2-methylphenyl)-N-[(2S)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[3-[butyl(cyclohexyl)amino]propyl]-2-(2-methylphenyl)-N-[(2S)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 88576007 |
| Molecular Formula | C32H46N2O2S |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 4-[3-[butyl(cyclohexyl)amino]propyl]-2-(2-methylphenyl)-N-[(2S)-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCCCN(CCCc1ccc(C(=O)N[C@H](C=O)CCSC)c(-c2ccccc2C)c1)C1CCCCC1 |
| InChI | InChI=1S/C32H46N2O2S/c1-4-5-20-34(28-14-7-6-8-15-28)21-11-13-26-17-18-30(32(36)33-27(24-35)19-22-37-3)31(23-26)29-16-10-9-12-25(29)2/h9-10,12,16-18,23-24,27-28H,4-8,11,13-15,19-22H2,1-3H3,(H,33,36)/t27-/m0/s1 |
| InChIKey | SBFACKLNCGBXFI-MHZLTWQESA-N |
| XLogP | 7.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|