C19H15ClF3NO2S — CID 88579663
(1S,5S)-3-[2-[4-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 88579663) has the molecular formula C19H15ClF3NO2S and a molecular weight of 413.85 g/mol. Its IUPAC name is (1S,5S)-3-[2-[4-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1S,5S)-3-[2-[4-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 88579663 |
| Molecular Formula | C19H15ClF3NO2S |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | (1S,5S)-3-[2-[4-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1sc(-c2ccc(Cl)cc2C(F)(F)F)nc1C1C(=O)[C@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C19H15ClF3NO2S/c1-8-15(14-16(25)9-2-3-10(6-9)17(14)26)24-18(27-8)12-5-4-11(20)7-13(12)19(21,22)23/h4-5,7,9-10,14H,2-3,6H2,1H3/t9-,10-/m0/s1 |
| InChIKey | GOPCKZDGEVSWAT-UWVGGRQHSA-N |
| XLogP | 5.44 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|