C16H33ClO — CID 88588584
8-chloro-3,3,5-trimethyl-4-propyldecan-4-ol (PubChem CID 88588584) has the molecular formula C16H33ClO and a molecular weight of 276.89 g/mol. Its IUPAC name is 8-chloro-3,3,5-trimethyl-4-propyldecan-4-ol.
| Compound Name | 8-chloro-3,3,5-trimethyl-4-propyldecan-4-ol |
|---|---|
| PubChem CID | 88588584 |
| Molecular Formula | C16H33ClO |
| Molecular Weight | 276.89 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 8-chloro-3,3,5-trimethyl-4-propyldecan-4-ol |
| SMILES | CCCC(O)(C(C)CCC(Cl)CC)C(C)(C)CC |
| InChI | InChI=1S/C16H33ClO/c1-7-12-16(18,15(5,6)9-3)13(4)10-11-14(17)8-2/h13-14,18H,7-12H2,1-6H3 |
| InChIKey | PGDSMVKXCRFRIK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|