C40H76N2O8S — CID 88595394
2,2-bis[[(Z)-octadec-9-enoyl]amino]ethyl 2,2-dihydroxyethyl sulfate (PubChem CID 88595394) has the molecular formula C40H76N2O8S and a molecular weight of 745.12 g/mol. Its IUPAC name is 2,2-bis[[(Z)-octadec-9-enoyl]amino]ethyl 2,2-dihydroxyethyl sulfate.
| Compound Name | 2,2-bis[[(Z)-octadec-9-enoyl]amino]ethyl 2,2-dihydroxyethyl sulfate |
|---|---|
| PubChem CID | 88595394 |
| Molecular Formula | C40H76N2O8S |
| Molecular Weight | 745.12 g/mol |
| Exact Mass | 744.53 |
| IUPAC Name | 2,2-bis[[(Z)-octadec-9-enoyl]amino]ethyl 2,2-dihydroxyethyl sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC(COS(=O)(=O)OCC(O)O)NC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C40H76N2O8S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(43)41-37(35-49-51(47,48)50-36-40(45)46)42-39(44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40,45-46H,3-16,21-36H2,1-2H3,(H,41,43)(H,42,44)/b19-17-,20-18- |
| InChIKey | LMEVORIXDFCXAF-CLFAGFIQSA-N |
| XLogP | 9.21 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.12 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|