C41H76O7S — CID 90761443
(2-hydroxy-3-methyl-3-octadec-9-enoyl-4-oxohenicos-12-enyl) methyl sulfate (PubChem CID 90761443) has the molecular formula C41H76O7S and a molecular weight of 713.12 g/mol. Its IUPAC name is (2-hydroxy-3-methyl-3-octadec-9-enoyl-4-oxohenicos-12-enyl) methyl sulfate.
| Compound Name | (2-hydroxy-3-methyl-3-octadec-9-enoyl-4-oxohenicos-12-enyl) methyl sulfate |
|---|---|
| PubChem CID | 90761443 |
| Molecular Formula | C41H76O7S |
| Molecular Weight | 713.12 g/mol |
| Exact Mass | 712.53 |
| IUPAC Name | (2-hydroxy-3-methyl-3-octadec-9-enoyl-4-oxohenicos-12-enyl) methyl sulfate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(C)(C(=O)CCCCCCCC=CCCCCCCCC)C(O)COS(=O)(=O)OC |
| InChI | InChI=1S/C41H76O7S/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38(42)41(3,40(44)37-48-49(45,46)47-4)39(43)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,40,44H,5-18,23-37H2,1-4H3 |
| InChIKey | UUSLWNUXGSSTFD-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.12 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|